C21H19NO4S — CID 71670366
ethyl 2-(2,5-dioxopyrrol-1-yl)-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 71670366) has the molecular formula C21H19NO4S and a molecular weight of 381.45 g/mol. Its IUPAC name is ethyl 2-(2,5-dioxopyrrol-1-yl)-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-(2,5-dioxopyrrol-1-yl)-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 71670366 |
| Molecular Formula | C21H19NO4S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | ethyl 2-(2,5-dioxopyrrol-1-yl)-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N2C(=O)C=CC2=O)sc2c1CCC(c1ccccc1)C2 |
| InChI | InChI=1S/C21H19NO4S/c1-2-26-21(25)19-15-9-8-14(13-6-4-3-5-7-13)12-16(15)27-20(19)22-17(23)10-11-18(22)24/h3-7,10-11,14H,2,8-9,12H2,1H3 |
| InChIKey | NWVSJMPMCNDUSX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|