C27H26N2O4S2 — CID 53269744
ethyl 2-[3-(4-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 53269744) has the molecular formula C27H26N2O4S2 and a molecular weight of 506.65 g/mol. Its IUPAC name is ethyl 2-[3-(4-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-(4-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 53269744 |
| Molecular Formula | C27H26N2O4S2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | ethyl 2-[3-(4-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N2C(=O)CC(Sc3ccc(N)cc3)C2=O)sc2c1CCC(c1ccccc1)C2 |
| InChI | InChI=1S/C27H26N2O4S2/c1-2-33-27(32)24-20-13-8-17(16-6-4-3-5-7-16)14-21(20)35-26(24)29-23(30)15-22(25(29)31)34-19-11-9-18(28)10-12-19/h3-7,9-12,17,22H,2,8,13-15,28H2,1H3 |
| InChIKey | LWQJYUPHSKSTAE-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|