C28H27N3O4S3 — CID 19059299
ethyl 2-[2,5-dioxo-3-[4-(phenylcarbamothioylamino)phenyl]sulfanylpyrrolidin-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19059299) has the molecular formula C28H27N3O4S3 and a molecular weight of 565.74 g/mol. Its IUPAC name is ethyl 2-[2,5-dioxo-3-[4-(phenylcarbamothioylamino)phenyl]sulfanylpyrrolidin-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[2,5-dioxo-3-[4-(phenylcarbamothioylamino)phenyl]sulfanylpyrrolidin-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19059299 |
| Molecular Formula | C28H27N3O4S3 |
| Molecular Weight | 565.74 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | ethyl 2-[2,5-dioxo-3-[4-(phenylcarbamothioylamino)phenyl]sulfanylpyrrolidin-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N2C(=O)CC(Sc3ccc(NC(=S)Nc4ccccc4)cc3)C2=O)sc2c1CCCC2 |
| InChI | InChI=1S/C28H27N3O4S3/c1-2-35-27(34)24-20-10-6-7-11-21(20)38-26(24)31-23(32)16-22(25(31)33)37-19-14-12-18(13-15-19)30-28(36)29-17-8-4-3-5-9-17/h3-5,8-9,12-15,22H,2,6-7,10-11,16H2,1H3,(H2,29,30,36) |
| InChIKey | KXCMGCBBYFCUMY-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.74 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|