C25H21N3O2S2 — CID 98470321
(6S)-2-[(3S)-3-(4-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 98470321) has the molecular formula C25H21N3O2S2 and a molecular weight of 459.60 g/mol. Its IUPAC name is (6S)-2-[(3S)-3-(4-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | (6S)-2-[(3S)-3-(4-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 98470321 |
| Molecular Formula | C25H21N3O2S2 |
| Molecular Weight | 459.60 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | (6S)-2-[(3S)-3-(4-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | N#Cc1c(N2C(=O)C[C@H](Sc3ccc(N)cc3)C2=O)sc2c1CC[C@H](c1ccccc1)C2 |
| InChI | InChI=1S/C25H21N3O2S2/c26-14-20-19-11-6-16(15-4-2-1-3-5-15)12-21(19)32-25(20)28-23(29)13-22(24(28)30)31-18-9-7-17(27)8-10-18/h1-5,7-10,16,22H,6,11-13,27H2/t16-,22-/m0/s1 |
| InChIKey | GFQDEZXFVGTVAX-AOMKIAJQSA-N |
| XLogP | 4.90 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.60 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|