C19H13F3N2O — CID 71674212
2,2,2-trifluoro-1-(4-phenylcyclopenta[c]cinnolin-1-yl)ethanol (PubChem CID 71674212) has the molecular formula C19H13F3N2O and a molecular weight of 342.32 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(4-phenylcyclopenta[c]cinnolin-1-yl)ethanol.
| Compound Name | 2,2,2-trifluoro-1-(4-phenylcyclopenta[c]cinnolin-1-yl)ethanol |
|---|---|
| PubChem CID | 71674212 |
| Molecular Formula | C19H13F3N2O |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 2,2,2-trifluoro-1-(4-phenylcyclopenta[c]cinnolin-1-yl)ethanol |
| SMILES | OC(c1ccc2n(-c3ccccc3)nc3ccccc3c1-2)C(F)(F)F |
| InChI | InChI=1S/C19H13F3N2O/c20-19(21,22)18(25)14-10-11-16-17(14)13-8-4-5-9-15(13)23-24(16)12-6-2-1-3-7-12/h1-11,18,25H |
| InChIKey | LAPUZOXCHXPOGM-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |