C22H22O4 — CID 71676392
[(4bS)-4b,7,8-trimethyl-1,4-dioxo-2-[(E)-prop-1-enyl]-5H-phenanthren-3-yl] acetate (PubChem CID 71676392) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is [(4bS)-4b,7,8-trimethyl-1,4-dioxo-2-[(E)-prop-1-enyl]-5H-phenanthren-3-yl] acetate.
| Compound Name | [(4bS)-4b,7,8-trimethyl-1,4-dioxo-2-[(E)-prop-1-enyl]-5H-phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 71676392 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | [(4bS)-4b,7,8-trimethyl-1,4-dioxo-2-[(E)-prop-1-enyl]-5H-phenanthren-3-yl] acetate |
| SMILES | C/C=C/C1=C(OC(C)=O)C(=O)C2=C(C=CC3=C(C)C(C)=CC[C@@]32C)C1=O |
| InChI | InChI=1S/C22H22O4/c1-6-7-16-19(24)15-8-9-17-13(3)12(2)10-11-22(17,5)18(15)20(25)21(16)26-14(4)23/h6-10H,11H2,1-5H3/b7-6+/t22-/m0/s1 |
| InChIKey | TTXFWZYIBNYDOI-WMWRJIBUSA-N |
| XLogP | 4.07 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|