C13H28N4O2S2 — CID 71677623
4-(2-hydroxyethyl)piperazine-1-carbodithioate;2-piperazin-4-ium-1-ylethanol (PubChem CID 71677623) has the molecular formula C13H28N4O2S2 and a molecular weight of 336.53 g/mol. Its IUPAC name is 4-(2-hydroxyethyl)piperazine-1-carbodithioate;2-piperazin-4-ium-1-ylethanol.
| Compound Name | 4-(2-hydroxyethyl)piperazine-1-carbodithioate;2-piperazin-4-ium-1-ylethanol |
|---|---|
| PubChem CID | 71677623 |
| Molecular Formula | C13H28N4O2S2 |
| Molecular Weight | 336.53 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 4-(2-hydroxyethyl)piperazine-1-carbodithioate;2-piperazin-4-ium-1-ylethanol |
| SMILES | OCCN1CCN(C(=S)[S-])CC1.OCCN1CC[NH2+]CC1 |
| InChI | InChI=1S/C7H14N2OS2.C6H14N2O/c10-6-5-8-1-3-9(4-2-8)7(11)12;9-6-5-8-3-1-7-2-4-8/h10H,1-6H2,(H,11,12);7,9H,1-6H2 |
| InChIKey | HIDKJEDZYPLMKK-UHFFFAOYSA-N |
| XLogP | -2.71 |
| TPSA | 66.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.53 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|