C23H20FN5O2 — CID 71678827
4-[[4-fluoro-3-(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-7-carbonyl)phenyl]methyl]-2H-phthalazin-1-one (PubChem CID 71678827) has the molecular formula C23H20FN5O2 and a molecular weight of 417.44 g/mol. Its IUPAC name is 4-[[4-fluoro-3-(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-7-carbonyl)phenyl]methyl]-2H-phthalazin-1-one.
| Compound Name | 4-[[4-fluoro-3-(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-7-carbonyl)phenyl]methyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 71678827 |
| Molecular Formula | C23H20FN5O2 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 4-[[4-fluoro-3-(3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-7-carbonyl)phenyl]methyl]-2H-phthalazin-1-one |
| SMILES | Cc1nnc2n1CCC(C(=O)c1cc(Cc3n[nH]c(=O)c4ccccc34)ccc1F)C2 |
| InChI | InChI=1S/C23H20FN5O2/c1-13-25-27-21-12-15(8-9-29(13)21)22(30)18-10-14(6-7-19(18)24)11-20-16-4-2-3-5-17(16)23(31)28-26-20/h2-7,10,15H,8-9,11-12H2,1H3,(H,28,31) |
| InChIKey | DUWFNUYZTCAHLX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |