C23H21ClFN3O3 — CID 177118656
4-[[3-[1-(2-chloroacetyl)piperidine-4-carbonyl]-4-fluorophenyl]methyl]-2H-phthalazin-1-one (PubChem CID 177118656) has the molecular formula C23H21ClFN3O3 and a molecular weight of 441.89 g/mol. Its IUPAC name is 4-[[3-[1-(2-chloroacetyl)piperidine-4-carbonyl]-4-fluorophenyl]methyl]-2H-phthalazin-1-one.
| Compound Name | 4-[[3-[1-(2-chloroacetyl)piperidine-4-carbonyl]-4-fluorophenyl]methyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 177118656 |
| Molecular Formula | C23H21ClFN3O3 |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 4-[[3-[1-(2-chloroacetyl)piperidine-4-carbonyl]-4-fluorophenyl]methyl]-2H-phthalazin-1-one |
| SMILES | O=C(c1cc(Cc2n[nH]c(=O)c3ccccc23)ccc1F)C1CCN(C(=O)CCl)CC1 |
| InChI | InChI=1S/C23H21ClFN3O3/c24-13-21(29)28-9-7-15(8-10-28)22(30)18-11-14(5-6-19(18)25)12-20-16-3-1-2-4-17(16)23(31)27-26-20/h1-6,11,15H,7-10,12-13H2,(H,27,31) |
| InChIKey | ZNDPFNJPNBHXGN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|