C33H38IN4+ — CID 71680023
2-methyl-5-[9-(2-methylpyrido[3,4-b]indol-2-ium-9-yl)nonyl]pyrido[4,3-b]indol-2-ium iodide (PubChem CID 71680023) has the molecular formula C33H38IN4+ and a molecular weight of 617.60 g/mol. Its IUPAC name is 2-methyl-5-[9-(2-methylpyrido[3,4-b]indol-2-ium-9-yl)nonyl]pyrido[4,3-b]indol-2-ium iodide.
| Compound Name | 2-methyl-5-[9-(2-methylpyrido[3,4-b]indol-2-ium-9-yl)nonyl]pyrido[4,3-b]indol-2-ium iodide |
|---|---|
| PubChem CID | 71680023 |
| Molecular Formula | C33H38IN4+ |
| Molecular Weight | 617.60 g/mol |
| Exact Mass | 617.21 |
| IUPAC Name | 2-methyl-5-[9-(2-methylpyrido[3,4-b]indol-2-ium-9-yl)nonyl]pyrido[4,3-b]indol-2-ium iodide |
| SMILES | C[n+]1ccc2c(c1)c1ccccc1n2CCCCCCCCCn1c2ccccc2c2cc[n+](C)cc21.[I-] |
| InChI | InChI=1S/C33H38N4.HI/c1-34-23-19-32-29(24-34)27-15-9-11-17-31(27)36(32)20-12-6-4-3-5-7-13-21-37-30-16-10-8-14-26(30)28-18-22-35(2)25-33(28)37;/h8-11,14-19,22-25H,3-7,12-13,20-21H2,1-2H3;1H/q+2;/p-1 |
| InChIKey | XXBGNSFQQFPZRU-UHFFFAOYSA-M |
| XLogP | 3.99 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.60 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|