C19H24BrClOSi — CID 71680631
[2-bromo-5-chloro-4-[(4-ethylphenyl)methyl]phenyl]methoxy-trimethylsilane (PubChem CID 71680631) has the molecular formula C19H24BrClOSi and a molecular weight of 411.84 g/mol. Its IUPAC name is [2-bromo-5-chloro-4-[(4-ethylphenyl)methyl]phenyl]methoxy-trimethylsilane.
| Compound Name | [2-bromo-5-chloro-4-[(4-ethylphenyl)methyl]phenyl]methoxy-trimethylsilane |
|---|---|
| PubChem CID | 71680631 |
| Molecular Formula | C19H24BrClOSi |
| Molecular Weight | 411.84 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | [2-bromo-5-chloro-4-[(4-ethylphenyl)methyl]phenyl]methoxy-trimethylsilane |
| SMILES | CCc1ccc(Cc2cc(Br)c(CO[Si](C)(C)C)cc2Cl)cc1 |
| InChI | InChI=1S/C19H24BrClOSi/c1-5-14-6-8-15(9-7-14)10-16-11-18(20)17(12-19(16)21)13-22-23(2,3)4/h6-9,11-12H,5,10,13H2,1-4H3 |
| InChIKey | IVYPHRPVRYZSED-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.84 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|