C25H32N4O2 — CID 71680879
N-cyclohexyl-2-(2-methylphenyl)-7-oxo-4-pentylpyrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 71680879) has the molecular formula C25H32N4O2 and a molecular weight of 420.56 g/mol. Its IUPAC name is N-cyclohexyl-2-(2-methylphenyl)-7-oxo-4-pentylpyrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-cyclohexyl-2-(2-methylphenyl)-7-oxo-4-pentylpyrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 71680879 |
| Molecular Formula | C25H32N4O2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | N-cyclohexyl-2-(2-methylphenyl)-7-oxo-4-pentylpyrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCCCn1cc(C(=O)NC2CCCCC2)c(=O)n2nc(-c3ccccc3C)cc12 |
| InChI | InChI=1S/C25H32N4O2/c1-3-4-10-15-28-17-21(24(30)26-19-12-6-5-7-13-19)25(31)29-23(28)16-22(27-29)20-14-9-8-11-18(20)2/h8-9,11,14,16-17,19H,3-7,10,12-13,15H2,1-2H3,(H,26,30) |
| InChIKey | BRARCMIUSRQKHO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|