C23H24BrNO6S — CID 71681259
dimethyl (2R,5R)-2-(4-bromophenyl)-5-ethenyl-1-(4-methylphenyl)sulfonylpyrrolidine-3,3-dicarboxylate (PubChem CID 71681259) has the molecular formula C23H24BrNO6S and a molecular weight of 522.42 g/mol. Its IUPAC name is dimethyl (2R,5R)-2-(4-bromophenyl)-5-ethenyl-1-(4-methylphenyl)sulfonylpyrrolidine-3,3-dicarboxylate.
| Compound Name | dimethyl (2R,5R)-2-(4-bromophenyl)-5-ethenyl-1-(4-methylphenyl)sulfonylpyrrolidine-3,3-dicarboxylate |
|---|---|
| PubChem CID | 71681259 |
| Molecular Formula | C23H24BrNO6S |
| Molecular Weight | 522.42 g/mol |
| Exact Mass | 521.05 |
| IUPAC Name | dimethyl (2R,5R)-2-(4-bromophenyl)-5-ethenyl-1-(4-methylphenyl)sulfonylpyrrolidine-3,3-dicarboxylate |
| SMILES | C=C[C@H]1CC(C(=O)OC)(C(=O)OC)[C@@H](c2ccc(Br)cc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H24BrNO6S/c1-5-18-14-23(21(26)30-3,22(27)31-4)20(16-8-10-17(24)11-9-16)25(18)32(28,29)19-12-6-15(2)7-13-19/h5-13,18,20H,1,14H2,2-4H3/t18-,20+/m0/s1 |
| InChIKey | ILRYIECIWSGEFQ-AZUAARDMSA-N |
| XLogP | 3.78 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|