C15H20O2 — CID 71683001
methyl (1R,2R,4R,7R,12R)-8-methylidenetetracyclo[5.3.2.02,4.04,12]dodecane-2-carboxylate (PubChem CID 71683001) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is methyl (1R,2R,4R,7R,12R)-8-methylidenetetracyclo[5.3.2.02,4.04,12]dodecane-2-carboxylate.
| Compound Name | methyl (1R,2R,4R,7R,12R)-8-methylidenetetracyclo[5.3.2.02,4.04,12]dodecane-2-carboxylate |
|---|---|
| PubChem CID | 71683001 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | methyl (1R,2R,4R,7R,12R)-8-methylidenetetracyclo[5.3.2.02,4.04,12]dodecane-2-carboxylate |
| SMILES | C=C1CC[C@@H]2C[C@@H]3[C@H]1CC[C@@]31C[C@@]21C(=O)OC |
| InChI | InChI=1S/C15H20O2/c1-9-3-4-10-7-12-11(9)5-6-14(12)8-15(10,14)13(16)17-2/h10-12H,1,3-8H2,2H3/t10-,11+,12-,14-,15+/m1/s1 |
| InChIKey | MYCUDJUGLNNEIW-OGMFBOKVSA-N |
| XLogP | 2.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|