C11H11N3O7-2 — CID 7168420
(2S)-2-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]butanedioate (PubChem CID 7168420) has the molecular formula C11H11N3O7-2 and a molecular weight of 297.22 g/mol. Its IUPAC name is (2S)-2-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]butanedioate.
| Compound Name | (2S)-2-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]butanedioate |
|---|---|
| PubChem CID | 7168420 |
| Molecular Formula | C11H11N3O7-2 |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | (2S)-2-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]butanedioate |
| SMILES | CN1C(=O)C(/C=N/[C@@H](CC(=O)[O-])C(=O)[O-])C(=O)N(C)C1=O |
| InChI | InChI=1S/C11H13N3O7/c1-13-8(17)5(9(18)14(2)11(13)21)4-12-6(10(19)20)3-7(15)16/h4-6H,3H2,1-2H3,(H,15,16)(H,19,20)/p-2/b12-4+/t6-/m0/s1 |
| InChIKey | OJUKTYIGMHSHNU-JSTDCQMXSA-L |
| XLogP | -4.02 |
| TPSA | 150.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | -4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|