C10H11N3O7 — CID 7694253
(2S)-2-[[(5S)-1-methyl-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]butanedioic acid (PubChem CID 7694253) has the molecular formula C10H11N3O7 and a molecular weight of 285.21 g/mol. Its IUPAC name is (2S)-2-[[(5S)-1-methyl-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]butanedioic acid.
| Compound Name | (2S)-2-[[(5S)-1-methyl-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]butanedioic acid |
|---|---|
| PubChem CID | 7694253 |
| Molecular Formula | C10H11N3O7 |
| Molecular Weight | 285.21 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | (2S)-2-[[(5S)-1-methyl-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]butanedioic acid |
| SMILES | CN1C(=O)NC(=O)[C@H](/C=N/[C@@H](CC(=O)O)C(=O)O)C1=O |
| InChI | InChI=1S/C10H11N3O7/c1-13-8(17)4(7(16)12-10(13)20)3-11-5(9(18)19)2-6(14)15/h3-5H,2H2,1H3,(H,14,15)(H,18,19)(H,12,16,20)/b11-3+/t4-,5-/m0/s1 |
| InChIKey | WJSMLGBLMNRCRN-JLAAMRNOSA-N |
| XLogP | -1.69 |
| TPSA | 153.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.21 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|