C12H15N3O7 — CID 7556496
(2S)-2-[[(5S)-2,4,6-trioxo-1-propan-2-yl-1,3-diazinan-5-yl]methylideneamino]butanedioic acid (PubChem CID 7556496) has the molecular formula C12H15N3O7 and a molecular weight of 313.27 g/mol. Its IUPAC name is (2S)-2-[[(5S)-2,4,6-trioxo-1-propan-2-yl-1,3-diazinan-5-yl]methylideneamino]butanedioic acid.
| Compound Name | (2S)-2-[[(5S)-2,4,6-trioxo-1-propan-2-yl-1,3-diazinan-5-yl]methylideneamino]butanedioic acid |
|---|---|
| PubChem CID | 7556496 |
| Molecular Formula | C12H15N3O7 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (2S)-2-[[(5S)-2,4,6-trioxo-1-propan-2-yl-1,3-diazinan-5-yl]methylideneamino]butanedioic acid |
| SMILES | CC(C)N1C(=O)NC(=O)[C@H](/C=N/[C@@H](CC(=O)O)C(=O)O)C1=O |
| InChI | InChI=1S/C12H15N3O7/c1-5(2)15-10(19)6(9(18)14-12(15)22)4-13-7(11(20)21)3-8(16)17/h4-7H,3H2,1-2H3,(H,16,17)(H,20,21)(H,14,18,22)/b13-4+/t6-,7-/m0/s1 |
| InChIKey | AMVDXZPDGAYKQM-XTSQMMKHSA-N |
| XLogP | -0.91 |
| TPSA | 153.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|