C14H14N4O3S — CID 71688068
N-(furan-2-ylmethyl)-N-methyl-1-pyridin-2-ylpyrazole-4-sulfonamide (PubChem CID 71688068) has the molecular formula C14H14N4O3S and a molecular weight of 318.36 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-methyl-1-pyridin-2-ylpyrazole-4-sulfonamide.
| Compound Name | N-(furan-2-ylmethyl)-N-methyl-1-pyridin-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 71688068 |
| Molecular Formula | C14H14N4O3S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-methyl-1-pyridin-2-ylpyrazole-4-sulfonamide |
| SMILES | CN(Cc1ccco1)S(=O)(=O)c1cnn(-c2ccccn2)c1 |
| InChI | InChI=1S/C14H14N4O3S/c1-17(10-12-5-4-8-21-12)22(19,20)13-9-16-18(11-13)14-6-2-3-7-15-14/h2-9,11H,10H2,1H3 |
| InChIKey | OYFVQKVXDRLPJY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 81.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |