C15H20N4O2S — CID 171133561
N-(cyclobutylmethyl)-N-ethyl-1-pyridin-2-ylpyrazole-4-sulfonamide (PubChem CID 171133561) has the molecular formula C15H20N4O2S and a molecular weight of 320.42 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-N-ethyl-1-pyridin-2-ylpyrazole-4-sulfonamide.
| Compound Name | N-(cyclobutylmethyl)-N-ethyl-1-pyridin-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 171133561 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | N-(cyclobutylmethyl)-N-ethyl-1-pyridin-2-ylpyrazole-4-sulfonamide |
| SMILES | CCN(CC1CCC1)S(=O)(=O)c1cnn(-c2ccccn2)c1 |
| InChI | InChI=1S/C15H20N4O2S/c1-2-18(11-13-6-5-7-13)22(20,21)14-10-17-19(12-14)15-8-3-4-9-16-15/h3-4,8-10,12-13H,2,5-7,11H2,1H3 |
| InChIKey | JWFOQKRRNWDRIT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |