C16H20N6O — CID 71689221
6-N-[1-(3-methoxyphenyl)ethyl]-8,9-dimethylpurine-2,6-diamine (PubChem CID 71689221) has the molecular formula C16H20N6O and a molecular weight of 312.38 g/mol. Its IUPAC name is 6-N-[1-(3-methoxyphenyl)ethyl]-8,9-dimethylpurine-2,6-diamine.
| Compound Name | 6-N-[1-(3-methoxyphenyl)ethyl]-8,9-dimethylpurine-2,6-diamine |
|---|---|
| PubChem CID | 71689221 |
| Molecular Formula | C16H20N6O |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 6-N-[1-(3-methoxyphenyl)ethyl]-8,9-dimethylpurine-2,6-diamine |
| SMILES | COc1cccc(C(C)Nc2nc(N)nc3c2nc(C)n3C)c1 |
| InChI | InChI=1S/C16H20N6O/c1-9(11-6-5-7-12(8-11)23-4)18-14-13-15(21-16(17)20-14)22(3)10(2)19-13/h5-9H,1-4H3,(H3,17,18,20,21) |
| InChIKey | LTSBBMNWDKFIIS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |