C17H22N6O2 — CID 71695883
8-[(E)-2-(1,3-dimethylpyrazol-4-yl)ethenyl]-1,3-diethyl-7-methylpurine-2,6-dione (PubChem CID 71695883) has the molecular formula C17H22N6O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 8-[(E)-2-(1,3-dimethylpyrazol-4-yl)ethenyl]-1,3-diethyl-7-methylpurine-2,6-dione.
| Compound Name | 8-[(E)-2-(1,3-dimethylpyrazol-4-yl)ethenyl]-1,3-diethyl-7-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 71695883 |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 8-[(E)-2-(1,3-dimethylpyrazol-4-yl)ethenyl]-1,3-diethyl-7-methylpurine-2,6-dione |
| SMILES | CCn1c(=O)c2c(nc(/C=C/c3cn(C)nc3C)n2C)n(CC)c1=O |
| InChI | InChI=1S/C17H22N6O2/c1-6-22-15-14(16(24)23(7-2)17(22)25)21(5)13(18-15)9-8-12-10-20(4)19-11(12)3/h8-10H,6-7H2,1-5H3/b9-8+ |
| InChIKey | REBPNIDGSCEANY-CMDGGOBGSA-N |
| XLogP | 1.15 |
| TPSA | 79.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|