C14H12N4 — CID 71696896
biphenylene-1,8-dicarboximidamide (PubChem CID 71696896) has the molecular formula C14H12N4 and a molecular weight of 236.28 g/mol. Its IUPAC name is biphenylene-1,8-dicarboximidamide.
| Compound Name | biphenylene-1,8-dicarboximidamide |
|---|---|
| PubChem CID | 71696896 |
| Molecular Formula | C14H12N4 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | biphenylene-1,8-dicarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc2c1=c1c(/C(N)=N/[H])cccc1=2 |
| InChI | InChI=1S/C14H12N4/c15-13(16)9-5-1-3-7-8-4-2-6-10(14(17)18)12(8)11(7)9/h1-6H,(H3,15,16)(H3,17,18) |
| InChIKey | BEMMBNMUJSKEHT-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|