C8H7N3S — CID 83677254
1,3-benzothiazole-4-carboximidamide (PubChem CID 83677254) has the molecular formula C8H7N3S and a molecular weight of 177.23 g/mol. Its IUPAC name is 1,3-benzothiazole-4-carboximidamide.
| Compound Name | 1,3-benzothiazole-4-carboximidamide |
|---|---|
| PubChem CID | 83677254 |
| Molecular Formula | C8H7N3S |
| Molecular Weight | 177.23 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 1,3-benzothiazole-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cccc2scnc12 |
| InChI | InChI=1S/C8H7N3S/c9-8(10)5-2-1-3-6-7(5)11-4-12-6/h1-4H,(H3,9,10) |
| InChIKey | MCGVACHPLRCADG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|