C22H27N3O2 — CID 71697037
N-[(2S)-2-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-2-hydroxy-2-quinolin-4-ylethyl]acetamide (PubChem CID 71697037) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-[(2S)-2-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-2-hydroxy-2-quinolin-4-ylethyl]acetamide.
| Compound Name | N-[(2S)-2-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-2-hydroxy-2-quinolin-4-ylethyl]acetamide |
|---|---|
| PubChem CID | 71697037 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | N-[(2S)-2-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-2-hydroxy-2-quinolin-4-ylethyl]acetamide |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@@](O)(CNC(C)=O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C22H27N3O2/c1-3-16-13-25-11-9-17(16)12-21(25)22(27,14-24-15(2)26)19-8-10-23-20-7-5-4-6-18(19)20/h3-8,10,16-17,21,27H,1,9,11-14H2,2H3,(H,24,26)/t16-,17-,21+,22+/m0/s1 |
| InChIKey | OYTXPJXXTWTESH-PEYKTXOXSA-N |
| XLogP | 2.45 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|