C27H31N3O — CID 71697038
(1S)-2-(benzylamino)-1-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-1-quinolin-4-ylethanol (PubChem CID 71697038) has the molecular formula C27H31N3O and a molecular weight of 413.57 g/mol. Its IUPAC name is (1S)-2-(benzylamino)-1-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-1-quinolin-4-ylethanol.
| Compound Name | (1S)-2-(benzylamino)-1-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-1-quinolin-4-ylethanol |
|---|---|
| PubChem CID | 71697038 |
| Molecular Formula | C27H31N3O |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | (1S)-2-(benzylamino)-1-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-1-quinolin-4-ylethanol |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@@](O)(CNCc1ccccc1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C27H31N3O/c1-2-21-18-30-15-13-22(21)16-26(30)27(31,19-28-17-20-8-4-3-5-9-20)24-12-14-29-25-11-7-6-10-23(24)25/h2-12,14,21-22,26,28,31H,1,13,15-19H2/t21-,22-,26+,27+/m0/s1 |
| InChIKey | IORYDTYTVBEJSX-DOQQYFFYSA-N |
| XLogP | 4.11 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|