C30H30N4O2 — CID 132607981
3-(benzylamino)-4-[[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 132607981) has the molecular formula C30H30N4O2 and a molecular weight of 478.60 g/mol. Its IUPAC name is 3-(benzylamino)-4-[[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(benzylamino)-4-[[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 132607981 |
| Molecular Formula | C30H30N4O2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 3-(benzylamino)-4-[[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@H](Nc1c(NCc2ccccc2)c(=O)c1=O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C30H30N4O2/c1-2-20-18-34-15-13-21(20)16-25(34)26(23-12-14-31-24-11-7-6-10-22(23)24)33-28-27(29(35)30(28)36)32-17-19-8-4-3-5-9-19/h2-12,14,20-21,25-26,32-33H,1,13,15-18H2/t20-,21-,25-,26+/m0/s1 |
| InChIKey | FERBNHDFZOPQBV-KZHJIPFUSA-N |
| XLogP | 4.49 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|