C29H29N4O2- — CID 135026430
3-(cyclopenta-1,4-dien-1-ylmethylamino)-4-[[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 135026430) has the molecular formula C29H29N4O2- and a molecular weight of 465.58 g/mol. Its IUPAC name is 3-(cyclopenta-1,4-dien-1-ylmethylamino)-4-[[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(cyclopenta-1,4-dien-1-ylmethylamino)-4-[[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 135026430 |
| Molecular Formula | C29H29N4O2- |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 3-(cyclopenta-1,4-dien-1-ylmethylamino)-4-[[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | C=CC1CN2CCC1CC2[C@H](Nc1c(NCc2cc[cH-]c2)c(=O)c1=O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C29H29N4O2/c1-2-19-17-33-14-12-20(19)15-24(33)25(22-11-13-30-23-10-6-5-9-21(22)23)32-27-26(28(34)29(27)35)31-16-18-7-3-4-8-18/h2-11,13,19-20,24-25,31-32H,1,12,14-17H2/q-1/t19?,20?,24?,25-/m1/s1 |
| InChIKey | VCSFGEFDNYDELP-GDTMBIGTSA-N |
| XLogP | 4.21 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|