C26H37N5OSi — CID 71696955
[(1S)-2-azido-1-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-1-quinolin-4-ylethoxy]-tert-butyl-dimethylsilane (PubChem CID 71696955) has the molecular formula C26H37N5OSi and a molecular weight of 463.70 g/mol. Its IUPAC name is [(1S)-2-azido-1-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-1-quinolin-4-ylethoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(1S)-2-azido-1-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-1-quinolin-4-ylethoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 71696955 |
| Molecular Formula | C26H37N5OSi |
| Molecular Weight | 463.70 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | [(1S)-2-azido-1-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-1-quinolin-4-ylethoxy]-tert-butyl-dimethylsilane |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@](CN=[N+]=[N-])(O[Si](C)(C)C(C)(C)C)c1ccnc2ccccc12 |
| InChI | InChI=1S/C26H37N5OSi/c1-7-19-17-31-15-13-20(19)16-24(31)26(18-29-30-27,32-33(5,6)25(2,3)4)22-12-14-28-23-11-9-8-10-21(22)23/h7-12,14,19-20,24H,1,13,15-18H2,2-6H3/t19-,20-,24+,26+/m0/s1 |
| InChIKey | UKBFMURNISXKGD-LTMJOFCKSA-N |
| XLogP | 6.66 |
| TPSA | 74.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.70 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|