C48H56BF2N3O2S — CID 71697076
4-(2,2-difluoro-4,6,8,10,12-pentamethyl-11-thiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-5-yl)-N,N-bis(4-hexoxyphenyl)aniline (PubChem CID 71697076) has the molecular formula C48H56BF2N3O2S and a molecular weight of 787.87 g/mol. Its IUPAC name is 4-(2,2-difluoro-4,6,8,10,12-pentamethyl-11-thiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-5-yl)-N,N-bis(4-hexoxyphenyl)aniline.
| Compound Name | 4-(2,2-difluoro-4,6,8,10,12-pentamethyl-11-thiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-5-yl)-N,N-bis(4-hexoxyphenyl)aniline |
|---|---|
| PubChem CID | 71697076 |
| Molecular Formula | C48H56BF2N3O2S |
| Molecular Weight | 787.87 g/mol |
| Exact Mass | 787.42 |
| IUPAC Name | 4-(2,2-difluoro-4,6,8,10,12-pentamethyl-11-thiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-5-yl)-N,N-bis(4-hexoxyphenyl)aniline |
| SMILES | CCCCCCOc1ccc(N(c2ccc(OCCCCCC)cc2)c2ccc(-c3c(C)c4n(c3C)[B-](F)(F)[N+]3=C(C)C(c5cccs5)=C(C)C3=C4C)cc2)cc1 |
| InChI | InChI=1S/C48H56BF2N3O2S/c1-8-10-12-14-30-55-42-26-22-40(23-27-42)52(41-24-28-43(29-25-41)56-31-15-13-11-9-2)39-20-18-38(19-21-39)45-33(3)47-35(5)48-34(4)46(44-17-16-32-57-44)37(7)54(48)49(50,51)53(47)36(45)6/h16-29,32H,8-15,30-31H2,1-7H3 |
| InChIKey | CJLLAHVVLOHMFY-UHFFFAOYSA-N |
| XLogP | 14.15 |
| TPSA | 29.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.87 |
| LogP ≤ 5 | 14.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|