C26H25ClN6O2 — CID 71697669
[5-(4-chlorophenyl)-1-(6-methoxypyridazin-3-yl)pyrazol-3-yl]-[4-(4-methylphenyl)piperazin-1-yl]methanone (PubChem CID 71697669) has the molecular formula C26H25ClN6O2 and a molecular weight of 488.98 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1-(6-methoxypyridazin-3-yl)pyrazol-3-yl]-[4-(4-methylphenyl)piperazin-1-yl]methanone.
| Compound Name | [5-(4-chlorophenyl)-1-(6-methoxypyridazin-3-yl)pyrazol-3-yl]-[4-(4-methylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 71697669 |
| Molecular Formula | C26H25ClN6O2 |
| Molecular Weight | 488.98 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | [5-(4-chlorophenyl)-1-(6-methoxypyridazin-3-yl)pyrazol-3-yl]-[4-(4-methylphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(-n2nc(C(=O)N3CCN(c4ccc(C)cc4)CC3)cc2-c2ccc(Cl)cc2)nn1 |
| InChI | InChI=1S/C26H25ClN6O2/c1-18-3-9-21(10-4-18)31-13-15-32(16-14-31)26(34)22-17-23(19-5-7-20(27)8-6-19)33(30-22)24-11-12-25(35-2)29-28-24/h3-12,17H,13-16H2,1-2H3 |
| InChIKey | ABXVXVMCSNDQIY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.98 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|