C19H19N3O3 — CID 71710146
14-cycloheptyl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11(15)-pentaene-5,12-dione (PubChem CID 71710146) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 14-cycloheptyl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11(15)-pentaene-5,12-dione.
| Compound Name | 14-cycloheptyl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11(15)-pentaene-5,12-dione |
|---|---|
| PubChem CID | 71710146 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 14-cycloheptyl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11(15)-pentaene-5,12-dione |
| SMILES | O=c1ccc2c(c1)oc1cc3c(=O)[nH]n(C4CCCCCC4)c3[nH]c12 |
| InChI | InChI=1S/C19H19N3O3/c23-12-7-8-13-15(9-12)25-16-10-14-18(20-17(13)16)22(21-19(14)24)11-5-3-1-2-4-6-11/h7-11,20H,1-6H2,(H,21,24) |
| InChIKey | SZISRDCTZXFABC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |