C26H22ClNO4S — CID 71711261
2-[6-chloro-3-methyl-4-[4-[(4-methylphenyl)sulfamoyl]phenyl]naphthalen-2-yl]acetic acid (PubChem CID 71711261) has the molecular formula C26H22ClNO4S and a molecular weight of 479.99 g/mol. Its IUPAC name is 2-[6-chloro-3-methyl-4-[4-[(4-methylphenyl)sulfamoyl]phenyl]naphthalen-2-yl]acetic acid.
| Compound Name | 2-[6-chloro-3-methyl-4-[4-[(4-methylphenyl)sulfamoyl]phenyl]naphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 71711261 |
| Molecular Formula | C26H22ClNO4S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | 2-[6-chloro-3-methyl-4-[4-[(4-methylphenyl)sulfamoyl]phenyl]naphthalen-2-yl]acetic acid |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(-c3c(C)c(CC(=O)O)cc4ccc(Cl)cc34)cc2)cc1 |
| InChI | InChI=1S/C26H22ClNO4S/c1-16-3-9-22(10-4-16)28-33(31,32)23-11-6-18(7-12-23)26-17(2)20(14-25(29)30)13-19-5-8-21(27)15-24(19)26/h3-13,15,28H,14H2,1-2H3,(H,29,30) |
| InChIKey | BFSKIKCELKYDJT-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |