C25H19Cl2NO4S — CID 71711382
2-[6-chloro-4-[4-[(3-chlorophenyl)sulfamoyl]phenyl]-3-methylnaphthalen-2-yl]acetic acid (PubChem CID 71711382) has the molecular formula C25H19Cl2NO4S and a molecular weight of 500.40 g/mol. Its IUPAC name is 2-[6-chloro-4-[4-[(3-chlorophenyl)sulfamoyl]phenyl]-3-methylnaphthalen-2-yl]acetic acid.
| Compound Name | 2-[6-chloro-4-[4-[(3-chlorophenyl)sulfamoyl]phenyl]-3-methylnaphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 71711382 |
| Molecular Formula | C25H19Cl2NO4S |
| Molecular Weight | 500.40 g/mol |
| Exact Mass | 499.04 |
| IUPAC Name | 2-[6-chloro-4-[4-[(3-chlorophenyl)sulfamoyl]phenyl]-3-methylnaphthalen-2-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)cc2ccc(Cl)cc2c1-c1ccc(S(=O)(=O)Nc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C25H19Cl2NO4S/c1-15-18(12-24(29)30)11-17-5-8-20(27)14-23(17)25(15)16-6-9-22(10-7-16)33(31,32)28-21-4-2-3-19(26)13-21/h2-11,13-14,28H,12H2,1H3,(H,29,30) |
| InChIKey | OCYFULQWYCOSIT-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.40 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |