C20H17FO4S — CID 71711573
2-[6-fluoro-3-methyl-4-(4-methylsulfonylphenyl)naphthalen-2-yl]acetic acid (PubChem CID 71711573) has the molecular formula C20H17FO4S and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-[6-fluoro-3-methyl-4-(4-methylsulfonylphenyl)naphthalen-2-yl]acetic acid.
| Compound Name | 2-[6-fluoro-3-methyl-4-(4-methylsulfonylphenyl)naphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 71711573 |
| Molecular Formula | C20H17FO4S |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 2-[6-fluoro-3-methyl-4-(4-methylsulfonylphenyl)naphthalen-2-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)cc2ccc(F)cc2c1-c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H17FO4S/c1-12-15(10-19(22)23)9-14-3-6-16(21)11-18(14)20(12)13-4-7-17(8-5-13)26(2,24)25/h3-9,11H,10H2,1-2H3,(H,22,23) |
| InChIKey | SEFRLOLAGCRLDS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |