C18H24N2O2Si — CID 71713267
(3aR,4S,6R,8aR,8bS)-4-[[dimethyl(phenyl)silyl]methyl]-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizine-6-carbonitrile (PubChem CID 71713267) has the molecular formula C18H24N2O2Si and a molecular weight of 328.49 g/mol. Its IUPAC name is (3aR,4S,6R,8aR,8bS)-4-[[dimethyl(phenyl)silyl]methyl]-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizine-6-carbonitrile.
| Compound Name | (3aR,4S,6R,8aR,8bS)-4-[[dimethyl(phenyl)silyl]methyl]-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizine-6-carbonitrile |
|---|---|
| PubChem CID | 71713267 |
| Molecular Formula | C18H24N2O2Si |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (3aR,4S,6R,8aR,8bS)-4-[[dimethyl(phenyl)silyl]methyl]-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizine-6-carbonitrile |
| SMILES | C[Si](C)(C[C@@H]1[C@H]2OCO[C@H]2[C@H]2CC[C@H](C#N)N21)c1ccccc1 |
| InChI | InChI=1S/C18H24N2O2Si/c1-23(2,14-6-4-3-5-7-14)11-16-18-17(21-12-22-18)15-9-8-13(10-19)20(15)16/h3-7,13,15-18H,8-9,11-12H2,1-2H3/t13-,15-,16-,17+,18-/m1/s1 |
| InChIKey | XARIUVPMCMMYMU-FXXCCUJSSA-N |
| XLogP | 2.08 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|