C24H28N2O2Si — CID 102140748
(2S,3aR,4S,8aR,8bS)-4-[[dimethyl(phenyl)silyl]methyl]-2-phenyl-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizine-6-carbonitrile (PubChem CID 102140748) has the molecular formula C24H28N2O2Si and a molecular weight of 404.59 g/mol. Its IUPAC name is (2S,3aR,4S,8aR,8bS)-4-[[dimethyl(phenyl)silyl]methyl]-2-phenyl-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizine-6-carbonitrile.
| Compound Name | (2S,3aR,4S,8aR,8bS)-4-[[dimethyl(phenyl)silyl]methyl]-2-phenyl-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizine-6-carbonitrile |
|---|---|
| PubChem CID | 102140748 |
| Molecular Formula | C24H28N2O2Si |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | (2S,3aR,4S,8aR,8bS)-4-[[dimethyl(phenyl)silyl]methyl]-2-phenyl-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizine-6-carbonitrile |
| SMILES | C[Si](C)(C[C@@H]1[C@H]2O[C@@H](c3ccccc3)O[C@H]2[C@H]2CCC(C#N)N21)c1ccccc1 |
| InChI | InChI=1S/C24H28N2O2Si/c1-29(2,19-11-7-4-8-12-19)16-21-23-22(20-14-13-18(15-25)26(20)21)27-24(28-23)17-9-5-3-6-10-17/h3-12,18,20-24H,13-14,16H2,1-2H3/t18?,20-,21-,22+,23-,24+/m1/s1 |
| InChIKey | ZNLITTORSMGLHI-WXEPTXMHSA-N |
| XLogP | 3.82 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|