C25H30N2O2Si — CID 135023083
(2S,3aR,4S,8aR,8bS)-4-[[dimethyl(phenyl)silyl]methyl]-6-methyl-2-phenyl-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizine-6-carbonitrile (PubChem CID 135023083) has the molecular formula C25H30N2O2Si and a molecular weight of 418.61 g/mol. Its IUPAC name is (2S,3aR,4S,8aR,8bS)-4-[[dimethyl(phenyl)silyl]methyl]-6-methyl-2-phenyl-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizine-6-carbonitrile.
| Compound Name | (2S,3aR,4S,8aR,8bS)-4-[[dimethyl(phenyl)silyl]methyl]-6-methyl-2-phenyl-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizine-6-carbonitrile |
|---|---|
| PubChem CID | 135023083 |
| Molecular Formula | C25H30N2O2Si |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | (2S,3aR,4S,8aR,8bS)-4-[[dimethyl(phenyl)silyl]methyl]-6-methyl-2-phenyl-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizine-6-carbonitrile |
| SMILES | CC1(C#N)CC[C@@H]2[C@@H]3O[C@H](c4ccccc4)O[C@@H]3[C@@H](C[Si](C)(C)c3ccccc3)N21 |
| InChI | InChI=1S/C25H30N2O2Si/c1-25(17-26)15-14-20-22-23(29-24(28-22)18-10-6-4-7-11-18)21(27(20)25)16-30(2,3)19-12-8-5-9-13-19/h4-13,20-24H,14-16H2,1-3H3/t20-,21-,22+,23-,24+,25?/m1/s1 |
| InChIKey | IKRJLNKASRVIPU-RWKCWNMCSA-N |
| XLogP | 4.21 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|