C32H36N2O3Si — CID 71713271
(2S,3aR,4S,8aR,8bS)-4-[[dimethyl(phenyl)silyl]methyl]-2-phenyl-6-(phenylmethoxymethyl)-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizine-6-carbonitrile (PubChem CID 71713271) has the molecular formula C32H36N2O3Si and a molecular weight of 524.74 g/mol. Its IUPAC name is (2S,3aR,4S,8aR,8bS)-4-[[dimethyl(phenyl)silyl]methyl]-2-phenyl-6-(phenylmethoxymethyl)-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizine-6-carbonitrile.
| Compound Name | (2S,3aR,4S,8aR,8bS)-4-[[dimethyl(phenyl)silyl]methyl]-2-phenyl-6-(phenylmethoxymethyl)-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizine-6-carbonitrile |
|---|---|
| PubChem CID | 71713271 |
| Molecular Formula | C32H36N2O3Si |
| Molecular Weight | 524.74 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | (2S,3aR,4S,8aR,8bS)-4-[[dimethyl(phenyl)silyl]methyl]-2-phenyl-6-(phenylmethoxymethyl)-3a,4,7,8,8a,8b-hexahydro-[1,3]dioxolo[4,5-a]pyrrolizine-6-carbonitrile |
| SMILES | C[Si](C)(C[C@@H]1[C@H]2O[C@@H](c3ccccc3)O[C@H]2[C@H]2CCC(C#N)(COCc3ccccc3)N21)c1ccccc1 |
| InChI | InChI=1S/C32H36N2O3Si/c1-38(2,26-16-10-5-11-17-26)21-28-30-29(36-31(37-30)25-14-8-4-9-15-25)27-18-19-32(22-33,34(27)28)23-35-20-24-12-6-3-7-13-24/h3-17,27-31H,18-21,23H2,1-2H3/t27-,28-,29+,30-,31+,32?/m1/s1 |
| InChIKey | WUVDUOYEKYFFNV-PXVXEHPUSA-N |
| XLogP | 5.41 |
| TPSA | 54.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.74 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|