C24H31NO2Si — CID 135023084
[(2S,3aR,4S,6R,8aR,8bS)-6-methyl-2-phenyl-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-4-yl]methyl-dimethyl-phenylsilane (PubChem CID 135023084) has the molecular formula C24H31NO2Si and a molecular weight of 393.60 g/mol. Its IUPAC name is [(2S,3aR,4S,6R,8aR,8bS)-6-methyl-2-phenyl-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-4-yl]methyl-dimethyl-phenylsilane.
| Compound Name | [(2S,3aR,4S,6R,8aR,8bS)-6-methyl-2-phenyl-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-4-yl]methyl-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 135023084 |
| Molecular Formula | C24H31NO2Si |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | [(2S,3aR,4S,6R,8aR,8bS)-6-methyl-2-phenyl-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-4-yl]methyl-dimethyl-phenylsilane |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H]3O[C@H](c4ccccc4)O[C@@H]3[C@@H](C[Si](C)(C)c3ccccc3)N12 |
| InChI | InChI=1S/C24H31NO2Si/c1-17-14-15-20-22-23(27-24(26-22)18-10-6-4-7-11-18)21(25(17)20)16-28(2,3)19-12-8-5-9-13-19/h4-13,17,20-24H,14-16H2,1-3H3/t17-,20-,21-,22+,23-,24+/m1/s1 |
| InChIKey | AJZPJGFVLWCUTE-FMYUWVRYSA-N |
| XLogP | 4.32 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|