C22H27NO3 — CID 135013548
(1S,2S,4R,5R,8S)-5-methyl-4-oxido-1,2-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium (PubChem CID 135013548) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is (1S,2S,4R,5R,8S)-5-methyl-4-oxido-1,2-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium.
| Compound Name | (1S,2S,4R,5R,8S)-5-methyl-4-oxido-1,2-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium |
|---|---|
| PubChem CID | 135013548 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | (1S,2S,4R,5R,8S)-5-methyl-4-oxido-1,2-bis(phenylmethoxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium |
| SMILES | C[C@@H]1CC[C@H]2[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)C[N@@+]12[O-] |
| InChI | InChI=1S/C22H27NO3/c1-17-12-13-20-22(26-16-19-10-6-3-7-11-19)21(14-23(17,20)24)25-15-18-8-4-2-5-9-18/h2-11,17,20-22H,12-16H2,1H3/t17-,20+,21+,22+,23-/m1/s1 |
| InChIKey | VXKSCZVVBYAVBY-QRYVVUSGSA-N |
| XLogP | 4.04 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|