C32H41NO2Si2 — CID 71713269
[(2S,3aR,4S,6R,8aR,8bS)-4-[[dimethyl(phenyl)silyl]methyl]-2-phenyl-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-6-yl]methyl-dimethyl-phenylsilane (PubChem CID 71713269) has the molecular formula C32H41NO2Si2 and a molecular weight of 527.86 g/mol. Its IUPAC name is [(2S,3aR,4S,6R,8aR,8bS)-4-[[dimethyl(phenyl)silyl]methyl]-2-phenyl-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-6-yl]methyl-dimethyl-phenylsilane.
| Compound Name | [(2S,3aR,4S,6R,8aR,8bS)-4-[[dimethyl(phenyl)silyl]methyl]-2-phenyl-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-6-yl]methyl-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 71713269 |
| Molecular Formula | C32H41NO2Si2 |
| Molecular Weight | 527.86 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | [(2S,3aR,4S,6R,8aR,8bS)-4-[[dimethyl(phenyl)silyl]methyl]-2-phenyl-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-6-yl]methyl-dimethyl-phenylsilane |
| SMILES | C[Si](C)(C[C@H]1CC[C@@H]2[C@@H]3O[C@H](c4ccccc4)O[C@@H]3[C@@H](C[Si](C)(C)c3ccccc3)N12)c1ccccc1 |
| InChI | InChI=1S/C32H41NO2Si2/c1-36(2,26-16-10-6-11-17-26)22-25-20-21-28-30-31(35-32(34-30)24-14-8-5-9-15-24)29(33(25)28)23-37(3,4)27-18-12-7-13-19-27/h5-19,25,28-32H,20-23H2,1-4H3/t25-,28-,29-,30+,31-,32+/m1/s1 |
| InChIKey | HGIWVLXAGJBNJL-JSJVQHDDSA-N |
| XLogP | 5.92 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.86 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|