C31H35NO5 — CID 135009090
(1S,8S,9R,10S)-11-benzyl-4,4-dimethyl-9-phenylmethoxy-10-(phenylmethoxymethyl)-3,5,7-trioxa-11-azatricyclo[6.3.0.02,6]undecane (PubChem CID 135009090) has the molecular formula C31H35NO5 and a molecular weight of 501.62 g/mol. Its IUPAC name is (1S,8S,9R,10S)-11-benzyl-4,4-dimethyl-9-phenylmethoxy-10-(phenylmethoxymethyl)-3,5,7-trioxa-11-azatricyclo[6.3.0.02,6]undecane.
| Compound Name | (1S,8S,9R,10S)-11-benzyl-4,4-dimethyl-9-phenylmethoxy-10-(phenylmethoxymethyl)-3,5,7-trioxa-11-azatricyclo[6.3.0.02,6]undecane |
|---|---|
| PubChem CID | 135009090 |
| Molecular Formula | C31H35NO5 |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | (1S,8S,9R,10S)-11-benzyl-4,4-dimethyl-9-phenylmethoxy-10-(phenylmethoxymethyl)-3,5,7-trioxa-11-azatricyclo[6.3.0.02,6]undecane |
| SMILES | CC1(C)OC2O[C@@H]3[C@H](OCc4ccccc4)[C@H](COCc4ccccc4)N(Cc4ccccc4)[C@@H]3C2O1 |
| InChI | InChI=1S/C31H35NO5/c1-31(2)36-29-26-28(35-30(29)37-31)27(34-20-24-16-10-5-11-17-24)25(21-33-19-23-14-8-4-9-15-23)32(26)18-22-12-6-3-7-13-22/h3-17,25-30H,18-21H2,1-2H3/t25-,26-,27+,28-,29?,30?/m0/s1 |
| InChIKey | MVDQBGNMGVZTMI-UBUOHEGQSA-N |
| XLogP | 4.92 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |