C39H45NO6 — CID 15384306
(3S)-3-[(3aS,4R,6R,6aR)-5-benzyl-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-3-(methoxymethoxy)propan-1-ol (PubChem CID 15384306) has the molecular formula C39H45NO6 and a molecular weight of 623.79 g/mol. Its IUPAC name is (3S)-3-[(3aS,4R,6R,6aR)-5-benzyl-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-3-(methoxymethoxy)propan-1-ol.
| Compound Name | (3S)-3-[(3aS,4R,6R,6aR)-5-benzyl-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-3-(methoxymethoxy)propan-1-ol |
|---|---|
| PubChem CID | 15384306 |
| Molecular Formula | C39H45NO6 |
| Molecular Weight | 623.79 g/mol |
| Exact Mass | 623.32 |
| IUPAC Name | (3S)-3-[(3aS,4R,6R,6aR)-5-benzyl-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-3-(methoxymethoxy)propan-1-ol |
| SMILES | COCO[C@@H](CCO)[C@@H]1[C@@H]2OC(C)(C)O[C@@H]2[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C39H45NO6/c1-38(2)45-36-33(40(26-29-16-8-4-9-17-29)35(37(36)46-38)34(24-25-41)43-28-42-3)27-44-39(30-18-10-5-11-19-30,31-20-12-6-13-21-31)32-22-14-7-15-23-32/h4-23,33-37,41H,24-28H2,1-3H3/t33-,34+,35-,36-,37+/m1/s1 |
| InChIKey | HJHCMKNPHXTBAA-ORIAJCIFSA-N |
| XLogP | 6.14 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.79 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|