C30H35NO5 — CID 53493542
(1R,2R,3R,5S,6S,7S,8S)-3-methyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol (PubChem CID 53493542) has the molecular formula C30H35NO5 and a molecular weight of 489.61 g/mol. Its IUPAC name is (1R,2R,3R,5S,6S,7S,8S)-3-methyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol.
| Compound Name | (1R,2R,3R,5S,6S,7S,8S)-3-methyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol |
|---|---|
| PubChem CID | 53493542 |
| Molecular Formula | C30H35NO5 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | (1R,2R,3R,5S,6S,7S,8S)-3-methyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol |
| SMILES | C[C@@H]1[C@@H](O)[C@H](O)[C@H]2[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](COCc3ccccc3)N21 |
| InChI | InChI=1S/C30H35NO5/c1-21-27(32)28(33)26-30(36-19-24-15-9-4-10-16-24)29(35-18-23-13-7-3-8-14-23)25(31(21)26)20-34-17-22-11-5-2-6-12-22/h2-16,21,25-30,32-33H,17-20H2,1H3/t21-,25+,26+,27-,28-,29+,30+/m1/s1 |
| InChIKey | QJALRBAJAKSDLE-CPCRXDFESA-N |
| XLogP | 3.55 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |