C33H39NO4S2 — CID 53493540
(2'R,3'R,5'S,6'S,7'S,8'R)-3'-methyl-6',7'-bis(phenylmethoxy)-5'-(phenylmethoxymethyl)spiro[1,3-dithiane-2,1'-2,3,5,6,7,8-hexahydropyrrolizine]-2'-ol (PubChem CID 53493540) has the molecular formula C33H39NO4S2 and a molecular weight of 577.81 g/mol. Its IUPAC name is (2'R,3'R,5'S,6'S,7'S,8'R)-3'-methyl-6',7'-bis(phenylmethoxy)-5'-(phenylmethoxymethyl)spiro[1,3-dithiane-2,1'-2,3,5,6,7,8-hexahydropyrrolizine]-2'-ol.
| Compound Name | (2'R,3'R,5'S,6'S,7'S,8'R)-3'-methyl-6',7'-bis(phenylmethoxy)-5'-(phenylmethoxymethyl)spiro[1,3-dithiane-2,1'-2,3,5,6,7,8-hexahydropyrrolizine]-2'-ol |
|---|---|
| PubChem CID | 53493540 |
| Molecular Formula | C33H39NO4S2 |
| Molecular Weight | 577.81 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | (2'R,3'R,5'S,6'S,7'S,8'R)-3'-methyl-6',7'-bis(phenylmethoxy)-5'-(phenylmethoxymethyl)spiro[1,3-dithiane-2,1'-2,3,5,6,7,8-hexahydropyrrolizine]-2'-ol |
| SMILES | C[C@@H]1[C@@H](O)C2(SCCCS2)[C@H]2[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](COCc3ccccc3)N12 |
| InChI | InChI=1S/C33H39NO4S2/c1-24-32(35)33(39-18-11-19-40-33)31-30(38-22-27-16-9-4-10-17-27)29(37-21-26-14-7-3-8-15-26)28(34(24)31)23-36-20-25-12-5-2-6-13-25/h2-10,12-17,24,28-32,35H,11,18-23H2,1H3/t24-,28+,29+,30-,31-,32-/m1/s1 |
| InChIKey | RXIXXHVTLBQXSZ-UDFMEQFMSA-N |
| XLogP | 5.76 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.81 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |