C29H33NO4 — CID 135018489
(2S,5S,6S,7S,8S)-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-ol (PubChem CID 135018489) has the molecular formula C29H33NO4 and a molecular weight of 459.59 g/mol. Its IUPAC name is (2S,5S,6S,7S,8S)-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-ol.
| Compound Name | (2S,5S,6S,7S,8S)-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-ol |
|---|---|
| PubChem CID | 135018489 |
| Molecular Formula | C29H33NO4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | (2S,5S,6S,7S,8S)-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-ol |
| SMILES | O[C@H]1C[C@H]2[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](COCc3ccccc3)N2C1 |
| InChI | InChI=1S/C29H33NO4/c31-25-16-26-28(33-19-23-12-6-2-7-13-23)29(34-20-24-14-8-3-9-15-24)27(30(26)17-25)21-32-18-22-10-4-1-5-11-22/h1-15,25-29,31H,16-21H2/t25-,26-,27-,28-,29-/m0/s1 |
| InChIKey | DMTOCUXEXKLSEB-ZIUUJSQJSA-N |
| XLogP | 4.19 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |