C33H39NO3S — CID 10792304
(1R,2R,3S,8S)-7-tert-butylsulfanyl-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,3,5,8-tetrahydro-1H-pyrrolizine (PubChem CID 10792304) has the molecular formula C33H39NO3S and a molecular weight of 529.75 g/mol. Its IUPAC name is (1R,2R,3S,8S)-7-tert-butylsulfanyl-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,3,5,8-tetrahydro-1H-pyrrolizine.
| Compound Name | (1R,2R,3S,8S)-7-tert-butylsulfanyl-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,3,5,8-tetrahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 10792304 |
| Molecular Formula | C33H39NO3S |
| Molecular Weight | 529.75 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | (1R,2R,3S,8S)-7-tert-butylsulfanyl-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,3,5,8-tetrahydro-1H-pyrrolizine |
| SMILES | CC(C)(C)SC1=CCN2[C@H]1[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H]2COCc1ccccc1 |
| InChI | InChI=1S/C33H39NO3S/c1-33(2,3)38-29-19-20-34-28(24-35-21-25-13-7-4-8-14-25)31(36-22-26-15-9-5-10-16-26)32(30(29)34)37-23-27-17-11-6-12-18-27/h4-19,28,30-32H,20-24H2,1-3H3/t28-,30+,31+,32+/m0/s1 |
| InChIKey | CBMXQUFBSHDPDD-NLSYYIHOSA-N |
| XLogP | 6.86 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.75 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |