C37H41NO5 — CID 134843174
(3aS,6R,7R,8S,8aS)-1-benzyl-3a-methoxy-6,7,8-tris(phenylmethoxy)-3,5,6,7,8,8a-hexahydro-2H-oxepino[3,2-b]pyrrole (PubChem CID 134843174) has the molecular formula C37H41NO5 and a molecular weight of 579.74 g/mol. Its IUPAC name is (3aS,6R,7R,8S,8aS)-1-benzyl-3a-methoxy-6,7,8-tris(phenylmethoxy)-3,5,6,7,8,8a-hexahydro-2H-oxepino[3,2-b]pyrrole.
| Compound Name | (3aS,6R,7R,8S,8aS)-1-benzyl-3a-methoxy-6,7,8-tris(phenylmethoxy)-3,5,6,7,8,8a-hexahydro-2H-oxepino[3,2-b]pyrrole |
|---|---|
| PubChem CID | 134843174 |
| Molecular Formula | C37H41NO5 |
| Molecular Weight | 579.74 g/mol |
| Exact Mass | 579.30 |
| IUPAC Name | (3aS,6R,7R,8S,8aS)-1-benzyl-3a-methoxy-6,7,8-tris(phenylmethoxy)-3,5,6,7,8,8a-hexahydro-2H-oxepino[3,2-b]pyrrole |
| SMILES | CO[C@]12CCN(Cc3ccccc3)[C@H]1[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)CO2 |
| InChI | InChI=1S/C37H41NO5/c1-39-37-22-23-38(24-29-14-6-2-7-15-29)36(37)35(42-27-32-20-12-5-13-21-32)34(41-26-31-18-10-4-11-19-31)33(28-43-37)40-25-30-16-8-3-9-17-30/h2-21,33-36H,22-28H2,1H3/t33-,34+,35-,36+,37+/m1/s1 |
| InChIKey | LLJOSVNGJLANLD-VIMWANRLSA-N |
| XLogP | 6.39 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.74 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |