C23H26N2O3 — CID 42612635
(3aS,4R,6S,6aR)-5-benzyl-2,2-dimethyl-6-(phenylmethoxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carbonitrile (PubChem CID 42612635) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is (3aS,4R,6S,6aR)-5-benzyl-2,2-dimethyl-6-(phenylmethoxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carbonitrile.
| Compound Name | (3aS,4R,6S,6aR)-5-benzyl-2,2-dimethyl-6-(phenylmethoxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carbonitrile |
|---|---|
| PubChem CID | 42612635 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | (3aS,4R,6S,6aR)-5-benzyl-2,2-dimethyl-6-(phenylmethoxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carbonitrile |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H](COCc1ccccc1)N(Cc1ccccc1)[C@@H]2C#N |
| InChI | InChI=1S/C23H26N2O3/c1-23(2)27-21-19(13-24)25(14-17-9-5-3-6-10-17)20(22(21)28-23)16-26-15-18-11-7-4-8-12-18/h3-12,19-22H,14-16H2,1-2H3/t19-,20+,21+,22-/m1/s1 |
| InChIKey | FUYJIFILUOGUIW-CLAROIROSA-N |
| XLogP | 3.50 |
| TPSA | 54.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |