C29H52N2O2Si3 — CID 74928403
5-[[dimethyl(phenyl)silyl]methyl]-6,7-bis(triethylsilyloxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-3-carbonitrile (PubChem CID 74928403) has the molecular formula C29H52N2O2Si3 and a molecular weight of 545.01 g/mol. Its IUPAC name is 5-[[dimethyl(phenyl)silyl]methyl]-6,7-bis(triethylsilyloxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-3-carbonitrile.
| Compound Name | 5-[[dimethyl(phenyl)silyl]methyl]-6,7-bis(triethylsilyloxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-3-carbonitrile |
|---|---|
| PubChem CID | 74928403 |
| Molecular Formula | C29H52N2O2Si3 |
| Molecular Weight | 545.01 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | 5-[[dimethyl(phenyl)silyl]methyl]-6,7-bis(triethylsilyloxy)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-3-carbonitrile |
| SMILES | CC[Si](CC)(CC)OC1C(O[Si](CC)(CC)CC)C(C[Si](C)(C)c2ccccc2)N2C(C#N)CCC12 |
| InChI | InChI=1S/C29H52N2O2Si3/c1-9-35(10-2,11-3)32-28-26-21-20-24(22-30)31(26)27(29(28)33-36(12-4,13-5)14-6)23-34(7,8)25-18-16-15-17-19-25/h15-19,24,26-29H,9-14,20-21,23H2,1-8H3 |
| InChIKey | JPUFDGHXINQKHS-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.01 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|